CAS 122185-11-9

4,4,15,15-Tetraethoxy-3,16-dioxa-4,15-disilaoctadecane

Description:

4,4,15,15-Tetraethoxy-3,16-dioxa-4,15-disilaoctadecane is a siloxane compound characterized by its unique structure, which includes both ethoxy groups and siloxane linkages. This compound features a long hydrocarbon chain, contributing to its hydrophobic properties, while the ethoxy groups enhance its solubility in organic solvents. The presence of oxygen atoms in the form of ether linkages provides potential for reactivity and interaction with other chemical species. Its siloxane backbone imparts flexibility and thermal stability, making it suitable for various applications, including as a surfactant, in coatings, or in materials science. The compound's molecular structure suggests it may exhibit interesting properties such as low surface tension and good wetting characteristics. Additionally, the presence of multiple functional groups allows for potential modifications, enabling its use in diverse chemical formulations. As with many siloxane compounds, it is essential to consider its environmental impact and biocompatibility in practical applications.

Formula: C₂₂H₅₀O₆Si₂

InChI: InChI=1S/C22H50O6Si2/c1-7-23-29(24-8-2,25-9-3)21-19-17-15-13-14-16-18-20-22-30(26-10-4,27-11-5)28-12-6/h7-22H2,1-6H3

InChI key: InChIKey=CSSDUQHQHMZSMM-UHFFFAOYSA-N

SMILES: [Si](CCCCCCCCCC[Si](OCC)(OCC)OCC)(OCC)(OCC)OCC

Synonyms:

• 4,4,15,15-Tetraethoxy-3,16-dioxa-4,15-disilaoctadecane
• 1,10-Bis(triethoxysilyl)decane
• 3,16-Dioxa-4,15-disilaoctadecane, 4,4,15,15-tetraethoxy-

3,16-Dioxa-4,15-disilaoctadecane, 4,4,15,15-tetraethoxy-

CAS: 122185-11-9

Formula: C₂₂H₅₀O₆Si₂

Molecular weight: 466.7998

Ref: IN-DA0016WS