
CAS 1222068-60-1
:1,1-Dimethylethyl N-[(5S)-5-amino-6-[(2,2-diethoxyethyl)(2-phenylethyl)amino]-6-oxohexyl]carbamate
Description:
1,1-Dimethylethyl N-[(5S)-5-amino-6-[(2,2-diethoxyethyl)(2-phenylethyl)amino]-6-oxohexyl]carbamate, with CAS number 1222068-60-1, is a synthetic organic compound characterized by its complex structure, which includes a carbamate functional group and multiple substituents that contribute to its biological activity. This compound features a chiral center, indicated by the (5S) configuration, which can influence its pharmacological properties and interactions with biological targets. The presence of the diethoxyethyl and phenylethyl groups suggests potential lipophilicity, which may enhance its membrane permeability and bioavailability. Additionally, the amino and oxo groups in the structure may play crucial roles in its reactivity and binding affinity to specific receptors or enzymes. Such compounds are often investigated for their potential therapeutic applications, particularly in fields like medicinal chemistry and drug development, where understanding their physicochemical properties, stability, and biological activity is essential for optimizing efficacy and safety profiles.
Formula:C25H43N3O5
InChI:InChI=1S/C25H43N3O5/c1-6-31-22(32-7-2)19-28(18-16-20-13-9-8-10-14-20)23(29)21(26)15-11-12-17-27-24(30)33-25(3,4)5/h8-10,13-14,21-22H,6-7,11-12,15-19,26H2,1-5H3,(H,27,30)/t21-/m0/s1
InChI key:InChIKey=AWQJEEUDDPKNGP-NRFANRHFSA-N
SMILES:N(CC(OCC)OCC)(CCC1=CC=CC=C1)C([C@H](CCCCNC(OC(C)(C)C)=O)N)=O
Synonyms:- 1,1-Dimethylethyl N-[(5S)-5-amino-6-[(2,2-diethoxyethyl)(2-phenylethyl)amino]-6-oxohexyl]carbamate
- Carbamic acid, N-[(5S)-5-amino-6-[(2,2-diethoxyethyl)(2-phenylethyl)amino]-6-oxohexyl]-, 1,1-dimethylethyl ester
- (s)-tert-Butyl (5-amino-6-((2,2-diethoxyethyl)(phenethyl)amino)-6-oxohexyl)carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.