CymitQuimica logo

CAS 1222068-68-9

:

(2S)-2-Amino-N-(2,2-diethoxyethyl)-N-(2-phenylethyl)-3-(phenylmethoxy)propanamide

Description:
(2S)-2-Amino-N-(2,2-diethoxyethyl)-N-(2-phenylethyl)-3-(phenylmethoxy)propanamide is a complex organic compound characterized by its specific stereochemistry and functional groups. The presence of an amino group (-NH2) indicates its classification as an amine, which contributes to its potential biological activity. The compound features a propanamide backbone, suggesting it has amide characteristics, which can influence its solubility and reactivity. The diethoxyethyl substituent enhances its lipophilicity, potentially affecting its pharmacokinetic properties. Additionally, the phenylethyl and phenylmethoxy groups may contribute to its aromaticity and could play a role in interactions with biological targets. The stereochemistry at the 2-position (S configuration) is crucial for its biological activity, as it may influence how the molecule interacts with enzymes or receptors. Overall, this compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies would be necessary to fully understand its properties and potential uses.
Formula:C24H34N2O4
InChI:InChI=1S/C24H34N2O4/c1-3-29-23(30-4-2)17-26(16-15-20-11-7-5-8-12-20)24(27)22(25)19-28-18-21-13-9-6-10-14-21/h5-14,22-23H,3-4,15-19,25H2,1-2H3/t22-/m0/s1
InChI key:InChIKey=OOHBEYDTRZGGDZ-QFIPXVFZSA-N
SMILES:N(CC(OCC)OCC)(CCC1=CC=CC=C1)C([C@H](COCC2=CC=CC=C2)N)=O
Synonyms:
  • Propanamide, 2-amino-N-(2,2-diethoxyethyl)-N-(2-phenylethyl)-3-(phenylmethoxy)-, (2S)-
  • (2S)-2-Amino-N-(2,2-diethoxyethyl)-N-(2-phenylethyl)-3-(phenylmethoxy)propanamide
  • (2s)-2-Amino-n-(2,2-diethoxyethyl)-n-(2-phenylethyl)-3-(phenylmethoxy)-propanamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.