CymitQuimica logo

CAS 1222098-11-4

:

Cyclopentanamine, 1-cyclopropyl-, hydrochloride (1:1)

Description:
Cyclopentanamine, 1-cyclopropyl-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and the presence of both cyclopentane and cyclopropane rings in its structure. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in water compared to its free base form. This compound may exhibit basic properties due to the amine group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and acid-base reactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as cyclic amines are often found in biologically active compounds. Additionally, the presence of the cyclopropyl group may influence its pharmacokinetic properties, such as lipophilicity and receptor binding affinity. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C8H15N·ClH
InChI:InChI=1S/C8H15N.ClH/c9-8(7-3-4-7)5-1-2-6-8;/h7H,1-6,9H2;1H
InChI key:InChIKey=POARZGPMEJFIRB-UHFFFAOYSA-N
SMILES:NC1(CCCC1)C2CC2.Cl
Synonyms:
  • Cyclopentanamine, 1-cyclopropyl-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.