
CAS 12221-09-9
:4,5-Dimethoxy-2-[2-[4-nitro-2-(phenylsulfonyl)phenyl]diazenyl]benzenediazonium
Description:
4,5-Dimethoxy-2-[2-[4-nitro-2-(phenylsulfonyl)phenyl]diazenyl]benzenediazonium, with the CAS number 12221-09-9, is a complex organic compound characterized by its azo structure, which features a diazo group (-N=N-) linking two aromatic systems. This compound contains multiple functional groups, including methoxy (-OCH3) and nitro (-NO2) groups, which contribute to its chemical reactivity and potential applications in dye chemistry. The presence of the phenylsulfonyl moiety enhances its solubility and stability in various solvents. Typically, diazonium compounds are known for their role in azo coupling reactions, making them valuable intermediates in the synthesis of azo dyes. The specific arrangement of substituents in this compound suggests potential applications in materials science, particularly in the development of colorants or as intermediates in organic synthesis. However, due to the presence of nitro and sulfonyl groups, it may also exhibit specific reactivity patterns, including electrophilic substitution and reduction reactions. Safety and handling precautions are essential due to the potential toxicity and reactivity of such compounds.
Formula:C20H16N5O6S
InChI:InChI=1S/C20H16N5O6S/c1-30-18-11-16(22-21)17(12-19(18)31-2)24-23-15-9-8-13(25(26)27)10-20(15)32(28,29)14-6-4-3-5-7-14/h3-12H,1-2H3/q+1
InChI key:InChIKey=HMDCSQAXBAPSLN-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=C(N=NC2=C([N+]#N)C=C(OC)C(OC)=C2)C=CC(N(=O)=O)=C1)C3=CC=CC=C3
Synonyms:- Benzenediazonium, 4,5-dimethoxy-2-[2-[4-nitro-2-(phenylsulfonyl)phenyl]diazenyl]-
- 4,5-Dimethoxy-2-[2-[4-nitro-2-(phenylsulfonyl)phenyl]diazenyl]benzenediazonium
- C.I. Azoic Diazo Component 134
- Fast Green Salt GT
- Benzenediazonium, 4,5-dimethoxy-2-[[4-nitro-2-(phenylsulfonyl)phenyl]azo]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzenediazonium, 4,5-dimethoxy-2-[2-[4-nitro-2-(phenylsulfonyl)phenyl]diazenyl]-
CAS:Formula:C20H16N5O6SMolecular weight:454.4359
