CAS 1222184-73-7
:3-Bromo-2,4-pyridinedicarboxylic acid
Description:
3-Bromo-2,4-pyridinedicarboxylic acid is a heterocyclic organic compound characterized by its pyridine ring structure, which is substituted with two carboxylic acid groups and a bromine atom. The presence of the bromine atom at the 3-position and the carboxylic acid groups at the 2 and 4 positions contributes to its unique chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid functional groups. Its acidic properties allow it to participate in various chemical reactions, such as esterification and amidation. Additionally, the bromine substituent can facilitate further functionalization, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3-Bromo-2,4-pyridinedicarboxylic acid is a valuable compound in synthetic chemistry with potential applications in diverse areas.
Formula:C7H4BrNO4
InChI:InChI=1S/C7H4BrNO4/c8-4-3(6(10)11)1-2-9-5(4)7(12)13/h1-2H,(H,10,11)(H,12,13)
InChI key:InChIKey=OMABVJASPNOYSD-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(Br)=C(C(O)=O)N=CC1
Synonyms:- 3-Bromo-2,4-pyridinedicarboxylic acid
- 2,4-Pyridinedicarboxylic acid, 3-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
