CymitQuimica logo

CAS 12223-30-2

:

3-[[4-[2-[2-Chloro-4-(methylsulfonyl)phenyl]diazenyl]-3-methylphenyl]ethylamino]propanenitrile

Description:
The chemical substance known as 3-[[4-[2-[2-Chloro-4-(methylsulfonyl)phenyl]diazenyl]-3-methylphenyl]ethylamino]propanenitrile, with the CAS number 12223-30-2, is a synthetic organic compound characterized by its complex structure, which includes a diazenyl group, a chloro substituent, and a nitrile functional group. This compound is typically classified as an azo dye or a related derivative due to the presence of the diazenyl linkage, which is known for its vibrant color properties. The methylsulfonyl group contributes to its solubility and reactivity, while the nitrile group can participate in various chemical reactions, including nucleophilic additions. The presence of multiple aromatic rings suggests potential applications in dye chemistry and materials science. Additionally, the compound's structure indicates possible biological activity, making it of interest in pharmaceutical research. However, specific safety and handling guidelines should be followed due to the presence of chlorine and other reactive groups, which may pose health and environmental risks.
Formula:C19H21ClN4O2S
InChI:InChI=1S/C19H21ClN4O2S/c1-4-24(11-5-10-21)15-6-8-18(14(2)12-15)22-23-19-9-7-16(13-17(19)20)27(3,25)26/h6-9,12-13H,4-5,11H2,1-3H3
InChI key:InChIKey=CALNYWCMOCMHSQ-UHFFFAOYSA-N
SMILES:N(CCC#N)(CC)C1=CC(C)=C(N=NC2=C(Cl)C=C(S(C)(=O)=O)C=C2)C=C1
Synonyms:
  • Propanenitrile, 3-[[4-[[2-chloro-4-(methylsulfonyl)phenyl]azo]-3-methylphenyl]ethylamino]-
  • Serisol Brilliant Orange WLS
  • Propanenitrile, 3-[[4-[2-[2-chloro-4-(methylsulfonyl)phenyl]diazenyl]-3-methylphenyl]ethylamino]-
  • C.I. Disperse Orange 52
  • 3-[[4-[2-[2-Chloro-4-(methylsulfonyl)phenyl]diazenyl]-3-methylphenyl]ethylamino]propanenitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.