
CAS 122235-70-5
:Boc-Dap(Fmoc)-OH
Description:
Boc-Dap(Fmoc)-OH, with the CAS number 122235-70-5, is a protected amino acid derivative commonly used in peptide synthesis. It features a 1,2-diaminopropane backbone, where the amino groups are protected by the Boc (tert-butyloxycarbonyl) and Fmoc (9-fluorenylmethoxycarbonyl) groups. These protective groups are crucial for selectively deprotecting the amino functionalities during the stepwise synthesis of peptides, allowing for the introduction of various amino acids in a controlled manner. The Boc group is typically removed under acidic conditions, while the Fmoc group can be cleaved using a base, providing versatility in synthetic strategies. This compound is generally stable under standard laboratory conditions but should be handled with care due to the potential reactivity of the amino groups. Its solubility in organic solvents makes it suitable for various coupling reactions in peptide chemistry. Overall, Boc-Dap(Fmoc)-OH serves as an important building block in the field of medicinal chemistry and biochemistry for the development of peptide-based therapeutics.
Formula:C23H26N2O6
InChI:InChI=1/C23H26N2O6/c1-23(2,3)31-22(29)25-19(20(26)27)12-24-21(28)30-13-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h4-11,18-19H,12-13H2,1-3H3,(H,24,28)(H,25,29)(H,26,27)/t19-/m0/s1
SMILES:CC(C)(C)OC(=N[C@@H](CN=C(O)OCC1c2ccccc2c2ccccc12)C(=O)O)O
Synonyms:- Boc-Dpr(Fmoc)-OH
- Boc-L-2,3-Diaminopropionic acid(Fmoc)
- 3-[(tert-butoxycarbonyl)amino]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-alanine
- N-(tert-butoxycarbonyl)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-L-alanine
- Boc-Dapa(Fmoc)-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(S)-2-(Boc-amino)-3-(Fmoc-amino)propionic acid, 98%
CAS:It has been used in the synthesis of target chelator, the tris-catechol compound 2. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item cFormula:C23H26N2O6Purity:98%Color and Shape:White, PowderMolecular weight:426.47Boc-Dap(Fmoc)-OH
CAS:Bachem ID: 4019047.
Formula:C23H26N2O6Purity:99.4%Color and Shape:White PowderMolecular weight:426.47L-Alanine, N-[(1,1-dimethylethoxy)carbonyl]-3-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-
CAS:Formula:C23H26N2O6Purity:97%Color and Shape:SolidMolecular weight:426.4623(S)-2,3-Diaminopropanoic acid, N2-BOC, N3-FMOC protected
CAS:(S)-2,3-Diaminopropanoic acid, N2-BOC, N3-FMOC protectedPurity:98%Molecular weight:426.46g/mol





