CymitQuimica logo

CAS 1222533-72-3

:

2-(Dimethoxymethyl)-6-fluoro-1,8-naphthyridine

Description:
2-(Dimethoxymethyl)-6-fluoro-1,8-naphthyridine is a chemical compound characterized by its unique structure, which includes a naphthyridine core substituted with a fluorine atom and a dimethoxymethyl group. This compound typically exhibits properties associated with heterocyclic aromatic compounds, such as moderate to high stability and potential solubility in organic solvents. The presence of the fluorine atom can enhance lipophilicity and influence the compound's biological activity, making it of interest in pharmaceutical research. The dimethoxymethyl group may also contribute to the compound's reactivity and interaction with biological targets. In terms of applications, compounds like this are often explored for their potential as drug candidates, particularly in the fields of medicinal chemistry and agrochemicals. Safety and handling considerations are essential, as with any chemical substance, and proper laboratory protocols should be followed when working with it. Overall, 2-(Dimethoxymethyl)-6-fluoro-1,8-naphthyridine represents a class of compounds that may have significant implications in various chemical and biological contexts.
Formula:C11H11FN2O2
InChI:InChI=1S/C11H11FN2O2/c1-15-11(16-2)9-4-3-7-5-8(12)6-13-10(7)14-9/h3-6,11H,1-2H3
InChI key:InChIKey=DAVIBRODJFTHQN-UHFFFAOYSA-N
SMILES:C(OC)(OC)C1=NC2=C(C=C1)C=C(F)C=N2
Synonyms:
  • 1,8-Naphthyridine, 2-(dimethoxymethyl)-6-fluoro-
  • 2-(Dimethoxymethyl)-6-fluoro-1,8-naphthyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.