CAS 1222533-88-1
:5-(Trifluoromethyl)-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid
Description:
5-(Trifluoromethyl)-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid is a complex organic compound characterized by its unique structural features, including a pyrrolo[2,3-b]pyridine core, a trifluoromethyl group, and a silyl substituent. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The tris(1-methylethyl)silyl group contributes to the compound's stability and solubility properties, which can be advantageous in various applications, including drug formulation and material science. As a carboxylic acid, it possesses acidic properties, allowing for potential interactions in biochemical systems. The compound's intricate structure suggests potential utility in the development of pharmaceuticals or agrochemicals, particularly in targeting specific biological pathways. Its synthesis and characterization would typically involve advanced organic chemistry techniques, and its behavior in different environments would be of interest for further research and application.
Formula:C18H25F3N2O2Si
InChI:InChI=1S/C18H25F3N2O2Si/c1-10(2)26(11(3)4,12(5)6)23-8-7-13-15(17(24)25)14(18(19,20)21)9-22-16(13)23/h7-12H,1-6H3,(H,24,25)
InChI key:InChIKey=LKEOFBNRUAFEDP-UHFFFAOYSA-N
SMILES:[Si](C(C)C)(C(C)C)(C(C)C)N1C=2C(C=C1)=C(C(O)=O)C(C(F)(F)F)=CN2
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine-4-carboxylic acid, 5-(trifluoromethyl)-1-[tris(1-methylethyl)silyl]-
- 5-(Trifluoromethyl)-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(Trifluoromethyl)-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid
CAS:Formula:C18H25F3N2O2SiMolecular weight:386.4840
