CymitQuimica logo

CAS 1222533-89-2

:

3,4-Dihydro-8-iodo-2H-pyrano[3,2-c]pyridine

Description:
3,4-Dihydro-8-iodo-2H-pyrano[3,2-c]pyridine is a heterocyclic organic compound characterized by its unique bicyclic structure that incorporates both a pyridine and a pyran ring. The presence of the iodine atom at the 8-position contributes to its reactivity and potential applications in medicinal chemistry. This compound typically exhibits properties associated with heterocycles, such as moderate solubility in organic solvents and potential biological activity. The dihydro form indicates that it has two hydrogen atoms added to the structure, which can influence its stability and reactivity. Its molecular framework suggests potential interactions with biological targets, making it of interest in drug discovery and development. Additionally, the compound may undergo various chemical reactions, including substitution and reduction, due to the presence of the iodine atom and the double bonds in the pyran ring. Overall, 3,4-Dihydro-8-iodo-2H-pyrano[3,2-c]pyridine is a compound of interest for further research in organic synthesis and pharmacology.
Formula:C8H8INO
InChI:InChI=1S/C8H8INO/c9-7-5-10-4-6-2-1-3-11-8(6)7/h4-5H,1-3H2
InChI key:InChIKey=IFEMHUGKZZFBLA-UHFFFAOYSA-N
SMILES:IC1=C2C(=CN=C1)CCCO2
Synonyms:
  • 3,4-Dihydro-8-iodo-2H-pyrano[3,2-c]pyridine
  • 2H-Pyrano[3,2-c]pyridine, 3,4-dihydro-8-iodo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.