
CAS 1222556-80-0
:5-(Chloromethyl)-2-(1-methylethyl)oxazole
Description:
5-(Chloromethyl)-2-(1-methylethyl)oxazole is a chemical compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. The presence of a chloromethyl group indicates that a chlorine atom is attached to a carbon that is also bonded to a methyl group, contributing to its reactivity and potential applications in organic synthesis. The isopropyl group (1-methylethyl) adds to the compound's hydrophobic character and can influence its solubility and interaction with biological systems. This compound may exhibit various properties such as moderate to high polarity, depending on the solvent, and could participate in nucleophilic substitution reactions due to the presence of the chloromethyl group. Its unique structure suggests potential utility in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. However, specific safety and handling guidelines should be followed, as halogenated compounds can pose environmental and health risks.
Formula:C7H10ClNO
InChI:InChI=1S/C7H10ClNO/c1-5(2)7-9-4-6(3-8)10-7/h4-5H,3H2,1-2H3
InChI key:InChIKey=CBAAZSZPDANZLL-UHFFFAOYSA-N
SMILES:C(C)(C)C=1OC(CCl)=CN1
Synonyms:- Oxazole, 5-(chloromethyl)-2-(1-methylethyl)-
- 5-(Chloromethyl)-2-(1-methylethyl)oxazole
- 5-Chloromethyl-2-isopropyloxazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.