CAS 122280-58-4
:5-(3,6-dihydro-2-oxo-2H-1,3,4-thiadiazin-5-yl)-1,3-dihydro-3- methyl-3-methylthio-2H-indol-2-one
Description:
The chemical substance known as 5-(3,6-dihydro-2-oxo-2H-1,3,4-thiadiazin-5-yl)-1,3-dihydro-3-methyl-3-methylthio-2H-indol-2-one, with the CAS number 122280-58-4, is characterized by its complex molecular structure, which includes both thiadiazine and indole moieties. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, which may include antimicrobial or anti-inflammatory effects. The presence of sulfur in the thiadiazine ring and the methylthio group can influence its reactivity and solubility in various solvents. Additionally, the indole structure is known for its role in various biochemical processes and can contribute to the compound's pharmacological properties. The compound's stability, solubility, and reactivity can vary based on environmental conditions and the presence of functional groups. Overall, this substance may be of interest in medicinal chemistry and drug development due to its unique structural features and potential therapeutic applications.
Formula:C13H13N3O2S2
InChI:InChI=1/C13H13N3O2S2/c1-13(19-2)8-5-7(3-4-9(8)14-11(13)17)10-6-20-12(18)16-15-10/h3-5H,6H2,1-2H3,(H,14,17)(H,16,18)
Synonyms:- 5-Dotmm-indol-2-one
- 1,3,4-Thiadiazin-2-one, 3,6-dihydro-5-(3-methyl-3-methylthio-2-oxo-1H-indol-5-yl)-
- 3-methyl-3-(methylsulfanyl)-5-(2-oxo-3,6-dihydro-2H-1,3,4-thiadiazin-5-yl)-1,3-dihydro-2H-indol-2-one
- 5-(3,6-Dihydro-2-oxo-2H-1,3,4-thiadiazin-5-yl)-1,3-dihydro-3-methyl-3-methylthio-2H-indol-2-one
- 5-(3-Methyl-3-methylthio-2-oxo-1H-indol-5-yl)-3,6-dihydro-1,3,4-thiadiazin-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2H-Indol-2-one, 5-(3,6-dihydro-2-oxo-2H-1,3,4-thiadiazin-5-yl)-1,3-dihydro-3-methyl-3-(methylthio)-
CAS:Formula:C13H13N3O2S2Molecular weight:307.3912
