CAS 122289-05-8
:4',5'-didehydro-5'-deoxy-5'-fluoroadenosine
Description:
4',5'-Didehydro-5'-deoxy-5'-fluoroadenosine, identified by its CAS number 122289-05-8, is a modified nucleoside analog of adenosine. This compound features a fluorine atom at the 5' position and lacks the hydroxyl group typically found in adenosine, which contributes to its unique chemical properties. The presence of the double bond between the 4' and 5' carbons introduces a degree of unsaturation, affecting its reactivity and interaction with biological systems. As a nucleoside analog, it may exhibit antiviral or anticancer properties by interfering with nucleic acid synthesis or function. Its structural modifications can enhance its stability against enzymatic degradation, making it a potential candidate for therapeutic applications. Additionally, the fluorine substitution can influence the compound's binding affinity to various biological targets, potentially leading to altered pharmacokinetics and pharmacodynamics. Overall, 4',5'-didehydro-5'-deoxy-5'-fluoroadenosine represents a significant area of interest in medicinal chemistry and drug development.
Formula:C10H10FN5O3
InChI:InChI=1/C10H10FN5O3/c11-1-4-6(17)7(18)10(19-4)16-3-15-5-8(12)13-2-14-9(5)16/h1-3,6-7,10,17-18H,(H2,12,13,14)/b4-1-/t6-,7+,10-/m1/s1
Synonyms:- Mdl 28842
- 4',5'-Didehydro-5'-deoxy-5'-fluoroarabinosyladenosine
- 4,5-Dddfa
- 9H-Purin-6-amine, 9-(5-deoxy-5-fluoro-beta-D-threo-pent-4-enofuranosyl)-, (Z)-
- 9-[(4Z)-5-deoxy-5-fluoro-beta-D-threo-pent-4-enofuranosyl]-9H-purin-6-amine
- 4',5'-Didehydro-5'-deoxy-5'-fluoroadenosine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
9H-Purin-6-amine, 9-[(4Z)-5-deoxy-5-fluoro-β-D-threo-pent-4-enofuranosyl]-
CAS:Formula:C10H10FN5O3Molecular weight:267.2165
