CAS 122294-09-1
:3',4'-DIMETHYL-BIPHENYL-4-CARBOXYLIC ACID
Description:
3',4'-Dimethyl-biphenyl-4-carboxylic acid, with the CAS number 122294-09-1, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two methyl groups at the 3' and 4' positions on one of the phenyl rings contributes to its hydrophobic nature, while the carboxylic acid functional group (-COOH) at the para position of the other ring imparts acidic properties. This compound is typically a white to off-white solid and is soluble in organic solvents, but its solubility in water is limited due to the hydrophobic biphenyl structure. It may exhibit interesting chemical reactivity due to the presence of the carboxylic acid group, allowing for potential applications in organic synthesis, pharmaceuticals, or as an intermediate in chemical manufacturing. Additionally, the methyl substituents can influence its physical properties, such as melting point and boiling point, as well as its interactions in biological systems.
Formula:C15H13O2
InChI:InChI=1/C15H14O2/c1-10-3-4-14(9-11(10)2)12-5-7-13(8-6-12)15(16)17/h3-9H,1-2H3,(H,16,17)/p-1
SMILES:Cc1ccc(cc1C)c1ccc(cc1)C(=O)[O-]
Synonyms:- 4-(3,4-Dimethylphenyl)benzoic acid
- 3',4'-Dimethylbiphenyl-4-Carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
