CAS 122299-11-0
:Eglin c (41-49)
Description:
Eglin C is a synthetic peptide derived from the venom of the green mamba snake, specifically designed for research purposes. It is classified as a potent inhibitor of serine proteases, which are enzymes that play critical roles in various biological processes, including blood coagulation and inflammation. The peptide consists of a specific sequence of amino acids that contributes to its structural stability and biological activity. Eglin C exhibits high specificity for certain proteases, making it a valuable tool in biochemical studies and potential therapeutic applications. Its molecular weight and structure allow it to interact effectively with target enzymes, inhibiting their activity and providing insights into protease function. Additionally, Eglin C's stability under physiological conditions enhances its utility in experimental settings. Researchers often utilize this peptide in studies related to enzyme inhibition, drug development, and understanding the mechanisms of protease-related diseases. Overall, Eglin C serves as an important compound in the field of biochemistry and pharmacology.
Formula:C48H78N12O15
InChI:InChI=1/C48H78N12O15/c1-23(2)18-31(41(68)53-30(11-9-17-52-48(49)50)40(67)55-33(20-27-12-14-28(63)15-13-27)43(70)58-35(22-61)47(74)75)54-44(71)34(21-36(64)65)56-42(69)32(19-24(3)4)57-46(73)38(26(7)62)60-45(72)37(25(5)6)59-39(66)29-10-8-16-51-29/h12-15,23-26,29-35,37-38,51,61-63H,8-11,16-22H2,1-7H3,(H,53,68)(H,54,71)(H,55,67)(H,56,69)(H,57,73)(H,58,70)(H,59,66)(H,60,72)(H,64,65)(H,74,75)(H4,49,50,52)/t26-,29+,30+,31+,32+,33+,34+,35+,37+,38+/m1/s1
Synonyms:- H-Ser-Pro-Val-Thr-Leu-Asp-Leu-Arg-Tyr-OH
- L-prolyl-L-valyl-L-threonyl-L-leucyl-L-alpha-aspartyl-L-leucyl-N~5~-(diaminomethylidene)-L-ornithyl-L-tyrosyl-L-serine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Eglin c (41-49)
CAS:Eglin C (41-49) is a synthetic peptide that has been shown to inhibit the function of human leukocytes. It has been used in analytical high-performance liquid chromatography (HPLC) for the separation of peptides with different functional groups. The sequence of this peptide is CPGGKTYCYC, and it is synthesized by cleaving a larger protein at the point where the amino acid sequence begins with the letter "E". Eglin C (41-49) has also been shown to be potently inhibitory against porcine pancreatic elastase and human leukocyte elastase.Formula:C48H78N12O15Purity:Min. 95%Color and Shape:PowderMolecular weight:1,063.2 g/mol
