CAS 1223-37-6
:1-Butyl 4-(phenylmethyl) butanedioate
Description:
1-Butyl 4-(phenylmethyl) butanedioate, with the CAS number 1223-37-6, is an organic compound characterized by its ester functional groups. It features a butyl chain and a phenylmethyl group attached to a butanedioate backbone, which contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid, exhibiting moderate solubility in organic solvents while being less soluble in water due to its hydrophobic characteristics. It has a relatively low volatility, making it stable under standard conditions. The presence of both aliphatic and aromatic components in its structure allows for potential applications in various fields, including as a plasticizer, flavoring agent, or in the synthesis of other organic compounds. Its reactivity can be influenced by the ester groups, which can undergo hydrolysis or transesterification under appropriate conditions. Safety data indicates that, like many organic esters, it should be handled with care to avoid inhalation or skin contact, as it may cause irritation.
Formula:C15H20O4
InChI:InChI=1S/C15H20O4/c1-2-3-11-18-14(16)9-10-15(17)19-12-13-7-5-4-6-8-13/h4-8H,2-3,9-12H2,1H3
InChI key:InChIKey=SISDVYCKRJTJHA-UHFFFAOYSA-N
SMILES:C(OC(CCC(OCCCC)=O)=O)C1=CC=CC=C1
Synonyms:- Butanedioic acid, butyl phenylmethyl ester
- Butanedioic acid, 1-butyl 4-(phenylmethyl) ester
- Succinic acid, benzyl butyl ester
- 1-Butyl 4-(phenylmethyl) butanedioate
- Benzyl butyl succinate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
