CAS 122308-25-2
:DIMETHYL 2-(THIOPHEN-2-YLMETHYL)MALONATE
Description:
Dimethyl 2-(thiophen-2-ylmethyl)malonate, with the CAS number 122308-25-2, is an organic compound characterized by its malonate structure, which features two ester groups attached to a central carbon atom. This compound contains a thiophene ring, a five-membered aromatic heterocycle containing sulfur, which contributes to its unique chemical properties and potential reactivity. The presence of the thiophenyl group can enhance the compound's electron-donating ability, making it useful in various chemical reactions, including those involving nucleophilic substitutions. Dimethyl 2-(thiophen-2-ylmethyl)malonate is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which makes it suitable for applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, its structure allows for potential applications in materials science, particularly in the synthesis of polymers or as intermediates in the production of more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C10H12O4S
InChI:InChI=1/C10H12O4S/c1-13-9(11)8(10(12)14-2)6-7-4-3-5-15-7/h3-5,8H,6H2,1-2H3
SMILES:COC(=O)C(Cc1cccs1)C(=O)OC
Synonyms:- Propanedioic Acid (2-Thienyl Methyl)Dimethyl Ester
- Dimethyl (2-thienylmethyl)malonate, 95%
- Dimethyl (Thiophen-2-Ylmethyl)Propanedioate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
