CymitQuimica logo

CAS 122321-03-3

:

4-[2-(METHYL-2-PYRIDINYLAMINO)ETHOXY]BENZALDEHYDE

Description:
4-[2-(Methyl-2-pyridinylamino)ethoxy]benzaldehyde, with the CAS number 122321-03-3, is an organic compound characterized by its complex structure that includes a benzaldehyde moiety and a pyridinylamino group. This compound typically exhibits properties associated with both aromatic aldehydes and nitrogen-containing heterocycles. It is likely to be a pale yellow to light brown solid or liquid, depending on its purity and specific formulation. The presence of the aldehyde functional group suggests it may participate in various chemical reactions, such as nucleophilic addition or condensation reactions. Additionally, the pyridine ring can contribute to the compound's solubility in polar solvents and its potential biological activity, making it of interest in medicinal chemistry. Its molecular interactions may be influenced by hydrogen bonding and π-π stacking due to the aromatic systems. Overall, this compound's unique structure may lend itself to applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis.
Formula:C15H16N2O2
InChI:InChI=1/C15H16N2O2/c1-17(15-4-2-3-9-16-15)10-11-19-14-7-5-13(12-18)6-8-14/h2-9,12H,10-11H2,1H3
SMILES:CN(CCOc1ccc(cc1)C=O)c1ccccn1
Synonyms:
  • 4-[2-[Methyl(Pyridine-2-Yl)Amino]Ethoxy]-Benzaldehyde
  • 4-{2-[Methyl(Pyridin-2-Yl)Amino]Ethoxy}Benzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.