CAS 122321-04-4
:2-[N-Methyl-N-(2-pyridyl)amino]ethanol
Description:
2-[N-Methyl-N-(2-pyridyl)amino]ethanol, with the CAS number 122321-04-4, is an organic compound characterized by its amine and alcohol functional groups. It features a pyridine ring, which contributes to its aromatic properties and potential for hydrogen bonding. The presence of the N-methyl group enhances its solubility in polar solvents, making it a versatile compound in various chemical applications. This substance is typically a colorless to pale yellow liquid, exhibiting moderate viscosity. Its molecular structure allows for potential interactions with biological systems, which may be of interest in pharmaceutical research. The compound's ability to form hydrogen bonds can influence its reactivity and stability, making it a candidate for use in synthesis or as a ligand in coordination chemistry. Additionally, its pyridine moiety may impart specific electronic properties, affecting its behavior in chemical reactions. Overall, 2-[N-Methyl-N-(2-pyridyl)amino]ethanol is a compound of interest in both industrial and research settings due to its unique structural features and functional capabilities.
Formula:C8H12N2O
InChI:InChI=1S/C8H12N2O/c1-10(6-7-11)8-4-2-3-5-9-8/h2-5,11H,6-7H2,1H3
InChI key:InChIKey=MWGKOPUDDQZERY-UHFFFAOYSA-N
SMILES:N(CCO)(C)C1=CC=CC=N1
Synonyms:- 2-(Methyl-2-pyridinylamino)ethanol
- 2-(Methyl-2-pyridylamino)ethanol
- 2-Methyl-2-Pyridinyl Amino) Ethanol
- 2-N-Methyl-2-pyridylaminoethanol
- 2-[(N-methyl-N-2-pyridinyl) amino]ethanol
- 2-[Methyl(Pyridin-2-Yl)Amino]Ethanol
- 2-[Methyl(pyridin-2-yl)amino]ethan-1-ol
- 2-[N-(2-Hydroxyethyl)-N-methylamino]pyridine
- 2-[N-Methyl-N-(pyridin-2-yl)amino]ethanol
- Ethanol, 2-(methyl-2-pyridinylamino)-
- 2-[N-Methyl-N-(2-pyridyl)amino]ethanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ethanol, 2-(methyl-2-pyridinylamino)-
CAS:Formula:C8H12N2OPurity:98%Color and Shape:LiquidMolecular weight:152.19372-[N-Methyl-N-(pyridin-2-yl)amino]ethanol
CAS:Controlled ProductFormula:C8H12N2OColor and Shape:NeatMolecular weight:152.192-[N-(2-Hydroxyethyl)-N-methylamino]pyridine
CAS:2-[N-(2-Hydroxyethyl)-N-methylamino]pyridinePurity:98%Molecular weight:152.19368g/mol2-(Methyl-2-pyridinylamino)ethanol
CAS:Formula:C8H12N2OPurity:97.0%Color and Shape:LiquidMolecular weight:152.1972-(Methyl-2-pyridylamino)ethanol
CAS:2-(Methyl-2-pyridylamino)ethanol (2MPE) is a small molecule that has been studied for its potential use as an inhibitor of the enzyme protein kinase C-alpha. The reaction mechanism of 2MPE with rosiglitazone, a drug used to treat type II diabetes mellitus, has been shown to be nucleophilic and proceeds through an addition-elimination mechanism. The kinetic parameters for this reaction have been determined by studying the effect of temperature on the reaction rate. Density measurements indicate that 2MPE is a low-molecular weight compound with a density of 1.08 g/mL at 25°C and 1 atm pressure. This study also found that microreactors are capable of producing high reaction yields in shorter amounts of time than larger reactors, making them well suited to the synthesis of small molecules such as 2MPE.Formula:C8H12N2OPurity:Min. 95%Molecular weight:152.19 g/mol




