CAS 122321-05-5

3-(cyclopropylcarbonyl)-5-methyl-4,5-dihydro-6H-imidazo[1,5-a][1,4]benzodiazepin-6-one

Description:

3-(Cyclopropylcarbonyl)-5-methyl-4,5-dihydro-6H-imidazo[1,5-a][1,4]benzodiazepin-6-one is a complex organic compound characterized by its unique bicyclic structure, which incorporates both imidazole and benzodiazepine moieties. This compound features a cyclopropylcarbonyl group, contributing to its distinct chemical reactivity and potential biological activity. The presence of a methyl group enhances its lipophilicity, which may influence its pharmacokinetic properties. The imidazo[1,5-a][1,4]benzodiazepine framework is known for its potential applications in medicinal chemistry, particularly in the development of anxiolytic and sedative agents. The compound's molecular structure suggests it may interact with various biological targets, possibly affecting neurotransmitter systems. Additionally, the presence of a carbonyl group indicates potential for hydrogen bonding and reactivity in various chemical environments. Overall, this compound exemplifies the intricate relationship between molecular structure and biological activity, making it a subject of interest in pharmaceutical research.

Formula: C₁₆H₁₅N₃O₂

InChI: InChI=1/C16H15N3O2/c1-18-8-13-14(15(20)10-6-7-10)17-9-19(13)12-5-3-2-4-11(12)16(18)21/h2-5,9-10H,6-8H2,1H3

Synonyms:

• 6H-Imidazo(1,5-a)(1,4)benzodiazepin-6-one, 3-(cyclopropylcarbonyl)-4,5-dihydro-5-methyl-

RU 33965

CAS: 122321-05-5

RU 33965, a 3-cyclopropyl carbonyl imidazobenzodiazepine, act as a low-efficacy benzodiazepine receptor inverse agonist.

Formula: C₁₆H₁₅N₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 281.31

Ref: TM-T26149