CAS 122324-16-7
:2-(morpholin-4-yl)pyrimidine-4,6-diamine
Description:
2-(Morpholin-4-yl)pyrimidine-4,6-diamine is a chemical compound characterized by its pyrimidine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features two amino groups at the 4 and 6 positions of the pyrimidine ring, contributing to its potential as a building block in medicinal chemistry. The presence of a morpholine group at the 2-position enhances its solubility and may influence its biological activity. Morpholine is a cyclic amine that can participate in hydrogen bonding, which may affect the compound's interactions with biological targets. This substance is often studied for its potential applications in pharmaceuticals, particularly in the development of drugs targeting various diseases. Its molecular structure suggests that it may exhibit properties such as moderate to high polarity, and it may be soluble in polar solvents. As with many compounds containing amine groups, it may also exhibit basicity, which can influence its reactivity and interactions in biological systems.
Formula:C8H13N5O
InChI:InChI=1/C8H13N5O/c9-6-5-7(10)12-8(11-6)13-1-3-14-4-2-13/h5H,1-4H2,(H4,9,10,11,12)
SMILES:C1COCCN1c1nc(cc(=N)[nH]1)N
Synonyms:- 4,6-Pyrimidinediamine, 2-(4-Morpholinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
