CAS 122332-18-7: Mivobulin
Description:Mivobulin, identified by the CAS number 122332-18-7, is a synthetic compound that belongs to the class of microtubule inhibitors. It is primarily studied for its potential applications in cancer therapy due to its ability to disrupt the normal function of microtubules, which are essential for cell division and intracellular transport. Mivobulin exhibits a mechanism of action similar to that of other tubulin-targeting agents, leading to cell cycle arrest and apoptosis in rapidly dividing cancer cells. The compound is characterized by its specific binding affinity to tubulin, which prevents the polymerization of microtubules, thereby inhibiting mitosis. In terms of physical properties, Mivobulin is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its pharmacokinetic profile, including absorption, distribution, metabolism, and excretion, is crucial for determining its efficacy and safety in clinical settings. Ongoing research continues to explore its therapeutic potential and optimize its formulation for better clinical outcomes.
Formula:C17H19N5O2
InChI:InChI=1/C17H19N5O2/c1-3-24-17(23)21-13-9-12-15(16(18)20-13)22-14(10(2)19-12)11-7-5-4-6-8-11/h4-10,19H,3H2,1-2H3,(H3,18,20,21,23)/t10-/m0/s1
- Synonyms:
- Ethyl N-[(9S)-5-amino-9-methyl-8-phenyl-4,7,10-triazabicyclo[4.4.0] deca-1,3,5,7-tetraen-3-yl]carbamate
- ethyl [(2S)-5-amino-2-methyl-3-phenyl-1,2-dihydropyrido[3,4-b]pyrazin-7-yl]carbamate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Mivobulin REF: TM-T12052CAS: 122332-18-7 | 98% | To inquire | Wed 14 May 25 |

Mivobulin
Ref: TM-T12052
25mg | To inquire |