CAS 122333-41-9

1-Propoxy-2(1H)-pyridinethione

Description:

1-Propoxy-2(1H)-pyridinethione, identified by its CAS number 122333-41-9, is a chemical compound that features a pyridine ring substituted with a propoxy group and a thione functional group. This compound exhibits characteristics typical of thiones, including potential reactivity due to the presence of the sulfur atom, which can participate in various chemical reactions such as nucleophilic attacks. The propoxy group contributes to the compound's hydrophobic properties, influencing its solubility and interaction with biological systems. Additionally, the pyridine moiety can engage in hydrogen bonding and π-π stacking interactions, which may affect the compound's stability and reactivity. The presence of both the thione and the propoxy group suggests potential applications in organic synthesis or as a building block in pharmaceutical chemistry. Overall, 1-Propoxy-2(1H)-pyridinethione is a compound of interest for its unique structural features and potential utility in various chemical contexts.

Formula: C₈H₁₁NOS

InChI: InChI=1S/C8H11NOS/c1-2-7-10-9-6-4-3-5-8(9)11/h3-6H,2,7H2,1H3

InChI key: InChIKey=WHSQIEVEMMKLTC-UHFFFAOYSA-N

SMILES: O(CCC)N1C(=S)C=CC=C1

Synonyms:

• 2(1H)-Pyridinethione, 1-propoxy-
• 1-Propoxy-2(1H)-pyridinethione

2(1H)-Pyridinethione, 1-propoxy-

CAS: 122333-41-9

Formula: C₈H₁₁NOS

Molecular weight: 169.244

Ref: IN-DA00174Q