CAS 12234-99-0

2,7-Naphthalenedisulfonic acid, 5-(benzoylamino)-4-hydroxy-3-[2-[2-(2-methylphenoxy)phenyl]diazenyl]-, sodium salt (1:2)

Description:

2,7-Naphthalenedisulfonic acid, 5-(benzoylamino)-4-hydroxy-3-[2-[2-(2-methylphenoxy)phenyl]diazenyl]-, sodium salt (1:2) is a complex organic compound characterized by its azo dye structure, which typically exhibits vibrant colors due to the presence of the azo (-N=N-) functional group. This compound features multiple sulfonic acid groups, contributing to its solubility in water and making it suitable for various applications in dyeing and as a dye intermediate. The presence of hydroxyl and amine functional groups enhances its reactivity and potential for forming hydrogen bonds, which can influence its behavior in different chemical environments. The sodium salt form indicates that it is likely to be more soluble in aqueous solutions, making it useful in various industrial applications, including textiles and inks. Additionally, the presence of aromatic rings suggests stability and potential for pi-pi interactions, which can affect its absorption properties and color characteristics. Overall, this compound is significant in the field of organic chemistry and materials science, particularly in dye synthesis and application.

Formula: C₃₀H₂₃N₃O₉S₂·2Na

InChI: InChI=1S/C30H23N3O9S2.2Na/c1-18-9-5-7-13-24(18)42-25-14-8-6-12-22(25)32-33-28-26(44(39,40)41)16-20-15-21(43(36,37)38)17-23(27(20)29(28)34)31-30(35)19-10-3-2-4-11-19;;/h2-17,34H,1H3,(H,31,35)(H,36,37,38)(H,39,40,41);;

InChI key: InChIKey=VRWQNFOXVWZWKQ-UHFFFAOYSA-N

SMILES: N(C(=O)C1=CC=CC=C1)C=2C3=C(C=C(S(=O)(=O)O)C(N=NC4=C(OC5=C(C)C=CC=C5)C=CC=C4)=C3O)C=C(S(=O)(=O)O)C2.[Na]

Synonyms:

• 2,7-Naphthalenedisulfonic acid, 5-(benzoylamino)-4-hydroxy-3-[[2-(2-methylphenoxy)phenyl]azo]-, disodium salt
• 2,7-Naphthalenedisulfonic acid, 5-(benzoylamino)-4-hydroxy-3-[2-[2-(2-methylphenoxy)phenyl]diazenyl]-, sodium salt (1:2)
• Erionyl Brilliant Red 3BN
• C.I. Acid Red 131
• Colomill Brilliant Red 3BN