CymitQuimica logo

CAS 1223404-90-7

:

5-[(2R)-2-(2,5-Difluorophenyl)-1-pyrrolidinyl]-3-nitropyrazolo[1,5-a]pyrimidine

Description:
5-[(2R)-2-(2,5-Difluorophenyl)-1-pyrrolidinyl]-3-nitropyrazolo[1,5-a]pyrimidine, with the CAS number 1223404-90-7, is a chemical compound characterized by its complex structure, which includes a nitro group and a pyrimidine ring fused with a pyrazole moiety. This compound features a pyrrolidine ring that is substituted with a difluorophenyl group, indicating the presence of fluorine atoms that can influence its electronic properties and biological activity. The stereochemistry at the pyrrolidine center is specified as (2R), which is crucial for its potential interactions in biological systems. The nitro group is known for its ability to participate in various chemical reactions, including reduction processes. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its solubility, stability, and reactivity would depend on the specific conditions and the presence of other functional groups in the environment. Overall, this compound represents a unique scaffold that could be explored for various applications in drug discovery.
Formula:C16H13F2N5O2
InChI:InChI=1S/C16H13F2N5O2/c17-10-3-4-12(18)11(8-10)13-2-1-6-21(13)15-5-7-22-16(20-15)14(9-19-22)23(24)25/h3-5,7-9,13H,1-2,6H2/t13-/m1/s1
InChI key:InChIKey=ZVNXKHRULOZLHG-CYBMUJFWSA-N
SMILES:FC1=C([C@@H]2N(CCC2)C3=NC=4N(C=C3)N=CC4N(=O)=O)C=C(F)C=C1
Synonyms:
  • 5-[(2R)-2-(2,5-Difluorophenyl)-1-pyrrolidinyl]-3-nitropyrazolo[1,5-a]pyrimidine
  • Pyrazolo[1,5-a]pyrimidine, 5-[(2R)-2-(2,5-difluorophenyl)-1-pyrrolidinyl]-3-nitro-
Found 5 products.