CAS 1223573-41-8: 1,1-Dimethylethyl 1-oxa-6-azaspiro[3.3]heptane-6-carboxylate
Description:1,1-Dimethylethyl 1-oxa-6-azaspiro[3.3]heptane-6-carboxylate, identified by its CAS number 1223573-41-8, is a chemical compound characterized by its unique spirocyclic structure, which includes a nitrogen atom and an oxygen atom within its framework. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility properties. The presence of the dimethyl group enhances steric hindrance, which can influence its interactions with other molecules. Typically, compounds with such structural characteristics may exhibit interesting biological activities, making them of interest in medicinal chemistry and drug design. The spirocyclic nature often leads to conformational rigidity, which can affect the compound's pharmacokinetics and dynamics. Additionally, the compound's stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, 1,1-Dimethylethyl 1-oxa-6-azaspiro[3.3]heptane-6-carboxylate represents a class of compounds that may have significant applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C10H17NO3
InChI:InChI=1S/C10H17NO3/c1-9(2,3)14-8(12)11-6-10(7-11)4-5-13-10/h4-7H2,1-3H3
InChI key:InChIKey=QOXFRPSIASGKGE-UHFFFAOYSA-N
SMILES:O=C(OC(C)(C)C)N1CC2(OCC2)C1
![discount label](https://static.cymitquimica.com/public/img/discount.png)
6-Boc-1-oxa-6-azaspiro[3.3]heptane, 96%
Ref: 02-H57040
250mg | To inquire |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
1-Oxa-6-azaspiro[3.3]heptane-6-carboxylic acid, 1,1-dimethylethyl ester
Ref: IN-DA001750
1g | 297.00 € | ||
5g | To inquire | ||
10g | To inquire | ||
100mg | 112.00 € | ||
250mg | 156.00 € | ||
500mg | 167.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
1-Oxa-6-azaspiro[3.3]heptane-6-carboxylic acid tert-butyl ester
Ref: 54-OR309129
1g | 325.00 € | ||
5g | 1,361.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Tert-Butyl 1-oxa-6-azaspiro[3.3]heptane-6-carboxylate
Ref: 10-F600384
1g | 350.00 € | ||
5g | 1,070.00 € | ||
10g | To inquire | ||
25g | To inquire | ||
100mg | 98.00 € | ||
250mg | 176.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
1-Oxa-6-azaspiro[3.3]heptane-6-carboxylic acid tert-butyl ester
Ref: 3D-YYB57341
1g | Discontinued | Request information | |
5mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |