CymitQuimica logo

CAS 1223573-45-2

:

6-[(4-Methylphenyl)sulfonyl]-1,6-diazaspiro[3.3]heptane

Description:
6-[(4-Methylphenyl)sulfonyl]-1,6-diazaspiro[3.3]heptane is a chemical compound characterized by its unique spirocyclic structure, which features a combination of nitrogen atoms and a sulfonyl group attached to a phenyl ring. The presence of the sulfonyl group contributes to its potential as a sulfonamide derivative, which may exhibit various biological activities. The compound's spiro structure, consisting of two interconnected rings, enhances its rigidity and may influence its interaction with biological targets. Additionally, the 4-methylphenyl substituent can affect the compound's lipophilicity and solubility, impacting its pharmacokinetic properties. This compound may be of interest in medicinal chemistry for its potential applications in drug development, particularly in the context of targeting specific receptors or enzymes. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties can be further explored through various analytical methods, including NMR spectroscopy and mass spectrometry, to confirm its structure and purity.
Formula:C12H16N2O2S
InChI:InChI=1S/C12H16N2O2S/c1-10-2-4-11(5-3-10)17(15,16)14-8-12(9-14)6-7-13-12/h2-5,13H,6-9H2,1H3
InChI key:InChIKey=LSCPFHZHQQBEQT-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1CC2(C1)CCN2)C3=CC=C(C)C=C3
Synonyms:
  • 6-[(4-Methylphenyl)sulfonyl]-1,6-diazaspiro[3.3]heptane
  • 1,6-Diazaspiro[3.3]heptane, 6-[(4-methylphenyl)sulfonyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.