CAS 12236-02-1

2-(3-Methoxypropyl)-9-methylbenzimidazo[2,1-b]benzo[lmn][3,8]phenanthroline-1,3,6(2H)-trione

Description:

2-(3-Methoxypropyl)-9-methylbenzimidazo[2,1-b]benzo[lmn][3,8]phenanthroline-1,3,6(2H)-trione, with CAS number 12236-02-1, is a complex organic compound characterized by its intricate polycyclic structure, which includes multiple fused aromatic rings and a benzimidazole moiety. This compound features a methoxypropyl substituent, contributing to its solubility and potential biological activity. The presence of the trione functional groups indicates that it may exhibit unique reactivity and properties, such as the ability to participate in hydrogen bonding or act as a chelating agent. Its structural complexity suggests potential applications in fields such as medicinal chemistry, where it may serve as a scaffold for drug development or as a fluorescent probe in biochemical assays. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents and the overall molecular conformation. Further studies would be necessary to elucidate its specific properties, biological activities, and potential applications in various scientific domains.

Formula: C₂₅H₁₉N₃O₄

InChI: InChI=1S/C25H19N3O4/c1-13-4-9-18-19(12-13)28-22(26-18)14-5-6-15-21-16(7-8-17(20(14)21)25(28)31)24(30)27(23(15)29)10-3-11-32-2/h4-9,12H,3,10-11H2,1-2H3

InChI key: InChIKey=WLXASJYYFAVYSK-UHFFFAOYSA-N

SMILES: O=C1C=2C=3C=4C(C(=O)N(CCCOC)C(=O)C4C=CC3C=5N1C=6C(N5)=CC=C(C)C6)=CC2

Synonyms:

• Duranol Brilliant Orange TG
• C.I. Disperse Orange 32
• Benzimidazo[2,1-b]benzo[lmn][3,8]phenanthroline-1,3,6(2H)-trione, 2-(3-methoxypropyl)-9-methyl-
• 2-(3-Methoxypropyl)-9-methylbenzimidazo[2,1-b]benzo[lmn][3,8]phenanthroline-1,3,6(2H)-trione
• Samaron Orange HFFG

C.I.Disperse Orange 32

CAS: 12236-02-1

Please enquire for more information about C.I.Disperse Orange 32 including the price, delivery time and more detailed product information at the technical inquiry form on this page

Purity: Min. 95%

Ref: 3D-FD41410