CAS 1223748-27-3

Benzamide, N-ethyl-N-methyl-3-(3-pyrrolidinyl)-, hydrochloride (1:1)

Description:

Benzamide, N-ethyl-N-methyl-3-(3-pyrrolidinyl)-, hydrochloride (1:1) is a chemical compound characterized by its structural features, which include a benzamide core substituted with ethyl and methyl groups on the nitrogen atom, as well as a pyrrolidine ring. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its handling in various applications. The presence of the pyrrolidine moiety suggests potential biological activity, as such structures are often associated with pharmacological properties. The compound may exhibit properties such as moderate to high lipophilicity due to the aromatic and aliphatic components, influencing its interaction with biological membranes. Additionally, the hydrochloride form indicates that it can be used in formulations requiring stability and ease of use. As with many benzamide derivatives, it may be of interest in medicinal chemistry for its potential therapeutic applications, although specific biological activities would require further investigation through empirical studies.

Formula: C₁₄H₂₀N₂O·ClH

InChI: InChI=1S/C14H20N2O.ClH/c1-3-16(2)14(17)12-6-4-5-11(9-12)13-7-8-15-10-13;/h4-6,9,13,15H,3,7-8,10H2,1-2H3;1H

InChI key: InChIKey=JRKOTWNXVJULFC-UHFFFAOYSA-N

SMILES: C(N(CC)C)(=O)C=1C=C(C=CC1)C2CCNC2.Cl

Synonyms:

• Benzamide, N-ethyl-N-methyl-3-(3-pyrrolidinyl)-, hydrochloride (1:1)