CymitQuimica logo

CAS 1223748-29-5

:

[3-(4-Cyanophenyl)-2-oxo-1-imidazolidinyl]acetic acid

Description:
[3-(4-Cyanophenyl)-2-oxo-1-imidazolidinyl]acetic acid, identified by its CAS number 1223748-29-5, is a chemical compound that features a unique imidazolidine structure. This compound is characterized by the presence of a cyanophenyl group, which contributes to its potential electronic and steric properties. The imidazolidine ring is known for its stability and ability to participate in various chemical reactions, while the acetic acid moiety provides acidic characteristics. The presence of the cyano group may enhance the compound's reactivity and solubility in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its specific properties, such as melting point, solubility, and reactivity, would depend on the molecular interactions and the environment in which it is studied. Overall, [3-(4-Cyanophenyl)-2-oxo-1-imidazolidinyl]acetic acid represents a class of compounds that could have diverse applications in medicinal chemistry and material science.
Formula:C12H11N3O3
InChI:InChI=1S/C12H11N3O3/c13-7-9-1-3-10(4-2-9)15-6-5-14(12(15)18)8-11(16)17/h1-4H,5-6,8H2,(H,16,17)
Synonyms:
  • 2-(3-(4-Cyanophenyl)-2-oxoimidazolidin-1-yl)acetic acid
  • [3-(4-Cyanophenyl)-2-oxo-imidazolidin-1-yl]aceticacid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.