CAS 1223748-30-8
:4-(Hydrazinylmethyl)-2-methylpyridine
Description:
4-(Hydrazinylmethyl)-2-methylpyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a hydrazinylmethyl group at the 4-position of the pyridine ring introduces significant reactivity, particularly in the context of forming hydrazones and other derivatives through condensation reactions. This compound typically exhibits properties associated with both pyridine and hydrazine derivatives, including potential basicity due to the nitrogen atoms. It may also display moderate solubility in polar solvents, influenced by the functional groups present. The compound's structure suggests potential applications in medicinal chemistry, particularly in the synthesis of bioactive molecules, due to the presence of both the hydrazine and pyridine functionalities, which are often found in pharmacologically active compounds. Additionally, its reactivity profile may allow for further functionalization, making it a valuable intermediate in organic synthesis. Safety and handling precautions should be observed, as hydrazine derivatives can be hazardous.
Formula:C7H11N3
InChI:InChI=1S/C7H11N3/c1-6-4-7(5-10-8)2-3-9-6/h2-4,10H,5,8H2,1H3
InChI key:InChIKey=RIKMSCWREYJNKE-UHFFFAOYSA-N
SMILES:C(NN)C=1C=C(C)N=CC1
Synonyms:- 4-(Hydrazinylmethyl)-2-methylpyridine
- Pyridine, 4-(hydrazinylmethyl)-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
