CymitQuimica logo

CAS 1223748-41-1

:

4-[2-(2-Bromoethoxy)phenyl]-4H-1,2,4-triazole

Description:
4-[2-(2-Bromoethoxy)phenyl]-4H-1,2,4-triazole is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a phenyl group substituted with a bromoethoxy moiety, enhancing its potential for various chemical interactions. The presence of the bromine atom may impart unique reactivity, making it useful in synthetic applications or as a building block in medicinal chemistry. The triazole structure is known for its biological activity, often exhibiting antifungal, antibacterial, or anticancer properties. Additionally, the compound's solubility and stability can be influenced by the substituents on the phenyl ring and the triazole itself. Its molecular properties, such as melting point, boiling point, and spectral characteristics, would be essential for practical applications and further research. Overall, this compound represents a versatile structure in organic synthesis and pharmaceutical development, with potential implications in various fields of chemistry and biology.
Formula:C10H10BrN3O
InChI:InChI=1S/C10H10BrN3O/c11-5-6-15-10-4-2-1-3-9(10)14-7-12-13-8-14/h1-4,7-8H,5-6H2
InChI key:InChIKey=YHEQHEDLYOOWFW-UHFFFAOYSA-N
SMILES:O(CCBr)C1=C(C=CC=C1)N2C=NN=C2
Synonyms:
  • 4-[2-(2-Bromoethoxy)phenyl]-4H-1,2,4-triazole
  • 4H-1,2,4-Triazole, 4-[2-(2-bromoethoxy)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.