CAS 1223748-52-4

7-Cyano-1H-indole-3-propanoic acid

Description:

7-Cyano-1H-indole-3-propanoic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a cyano group (-CN) at the 7-position and a propanoic acid moiety at the 3-position of the indole ring. The presence of the cyano group contributes to its potential reactivity and ability to participate in various chemical reactions, while the propanoic acid group introduces acidity and can influence solubility and biological activity. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. Additionally, its unique functional groups may allow for further derivatization, making it a valuable intermediate in organic synthesis. As with many indole derivatives, it may also possess interesting photophysical properties, which could be explored in various applications, including fluorescence and sensor technologies.

Formula: C₁₂H₁₀N₂O₂

InChI: InChI=1S/C12H10N2O2/c13-6-8-2-1-3-10-9(4-5-11(15)16)7-14-12(8)10/h1-3,7,14H,4-5H2,(H,15,16)

InChI key: InChIKey=CFMSWGCGTBAMCW-UHFFFAOYSA-N

SMILES: C(CC(O)=O)C=1C=2C(=C(C#N)C=CC2)NC1

Synonyms:

• 1H-Indole-3-propanoic acid, 7-cyano-
• 7-Cyano-1H-indole-3-propanoic acid