CymitQuimica logo

CAS 1223748-53-5

:

2-Amino-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-4-carboxamide

Description:
2-Amino-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-4-carboxamide is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound features an amino group and a carboxamide functional group, contributing to its potential as a bioactive molecule. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the carboxamide group. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its molecular interactions may involve hydrogen bonding and π-π stacking due to the aromatic nature of the rings. Additionally, the presence of multiple nitrogen atoms in the structure may influence its reactivity and binding affinity in biological systems. Overall, 2-Amino-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-4-carboxamide represents a class of compounds that could be of interest for further research in drug discovery and development.
Formula:C8H11N5O
InChI:InChI=1S/C8H11N5O/c9-7(14)6-4-3-11-2-1-5(4)12-8(10)13-6/h11H,1-3H2,(H2,9,14)(H2,10,12,13)
InChI key:InChIKey=YPNGJXZBJVKMCT-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=C2C(=NC(N)=N1)CCNC2
Synonyms:
  • 2-Amino-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine-4-carboxamide
  • Pyrido[4,3-d]pyrimidine-4-carboxamide, 2-amino-5,6,7,8-tetrahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.