CymitQuimica logo

CAS 122377-19-9

:

2-pyridyl-[4-(trifluoromethyl)phenyl]methanone

Description:
2-Pyridyl-[4-(trifluoromethyl)phenyl]methanone, with the CAS number 122377-19-9, is an organic compound characterized by its complex structure, which includes a pyridine ring and a phenyl group substituted with a trifluoromethyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including stability and potential reactivity due to the presence of the carbonyl group. The trifluoromethyl group is known to enhance lipophilicity and can influence the compound's biological activity, making it of interest in medicinal chemistry. Additionally, the presence of the pyridine moiety may contribute to its ability to act as a ligand in coordination chemistry. The compound is likely to be soluble in organic solvents and may exhibit moderate to high melting and boiling points, typical of similar aromatic compounds. Its unique structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. However, specific physical and chemical properties would need to be determined experimentally or sourced from reliable databases for precise applications.
Formula:C13H8F3NO
InChI:InChI=1/C13H8F3NO/c14-13(15,16)10-6-4-9(5-7-10)12(18)11-3-1-2-8-17-11/h1-8H
SMILES:c1ccnc(c1)C(=O)c1ccc(cc1)C(F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.