CAS 1224-08-4
:il40
Description:
The chemical substance known as IL-40, with the CAS number 1224-08-4, is a type of ionic liquid. Ionic liquids are salts that are liquid at relatively low temperatures and are composed entirely of ions. IL-40 is characterized by its low volatility, high thermal stability, and ability to dissolve a wide range of organic and inorganic materials. These properties make it an attractive solvent for various chemical reactions and processes, including catalysis and extraction. Additionally, ionic liquids like IL-40 often exhibit tunable properties, allowing for modifications in their physical and chemical characteristics by altering the cation or anion components. This versatility has led to their increasing use in green chemistry applications, as they can reduce the environmental impact of chemical processes. However, specific details regarding its toxicity, solubility, and reactivity would require further investigation, as these factors can vary based on the specific formulation and application of the ionic liquid.
Formula:C15H13N3O2
InChI:InChI=1/C15H13N3O2/c16-18-13(19)15(17-14(18)20,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,16H2,(H,17,20)
SMILES:c1ccc(cc1)C1(c2ccccc2)C(=O)N(C(=N1)O)N
Synonyms:- 3-Amino-5,5-Diphenyl-Hydantoi
- 3-Amino-5,5-Diphenylhydantoin
- N-aminodiphenylhydantoin
- 3-Amino-5,5-Diphenylimidazolidine-2,4-Dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
