CAS 1224095-98-0

N⁴,N⁶-Bis[3-[[5-[(aminoiminomethyl)amino]-1-oxopentyl]amino]-2-[(3R)-3-pyrrolidinyloxy]-5-(trifluoromethyl)phenyl]-4,6-pyrimidinedicarboxamide

Description:

N⁴,N⁶-Bis[3-[[5-[(aminoiminomethyl)amino]-1-oxopentyl]amino]-2-[(3R)-3-pyrrolidinyloxy]-5-(trifluoromethyl)phenyl]-4,6-pyrimidinedicarboxamide, with CAS number 1224095-98-0, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as amides, amino groups, and a pyrimidine ring. This compound is notable for its potential biological activity, particularly in the context of medicinal chemistry, where it may serve as a lead compound for the development of therapeutic agents. The presence of trifluoromethyl groups often enhances the lipophilicity and metabolic stability of the molecule, while the pyrrolidine moiety may contribute to its interaction with biological targets. Its synthesis and characterization would typically involve advanced organic chemistry techniques, and its properties, such as solubility, stability, and reactivity, would be influenced by the specific arrangement of its functional groups. Further studies would be necessary to elucidate its pharmacological profile and potential applications in drug development.

Formula: C₄₀H₅₀F₆N₁₄O₆

InChI: InChI=1S/C40H50F6N14O6/c41-39(42,43)21-13-25(57-31(61)5-1-3-9-53-37(47)48)33(65-23-7-11-51-18-23)27(15-21)59-35(63)29-17-30(56-20-55-29)36(64)60-28-16-22(40(44,45)46)14-26(34(28)66-24-8-12-52-19-24)58-32(62)6-2-4-10-54-38(49)50/h13-17,20,23-24,51-52H,1-12,18-19H2,(H,57,61)(H,58,62)(H,59,63)(H,60,64)(H4,47,48,53)(H4,49,50,54)/t23-,24-/m1/s1

InChI key: InChIKey=QPDYBCZNGUJZDK-DNQXCXABSA-N

SMILES: O(C1=C(NC(=O)C=2C=C(C(NC3=C(O[C@@H]4CCNC4)C(NC(CCCCNC(=N)N)=O)=CC(C(F)(F)F)=C3)=O)N=CN2)C=C(C(F)(F)F)C=C1NC(CCCCNC(=N)N)=O)[C@@H]5CCNC5

Brilacidin

CAS: 1224095-98-0

Brilacidin is a nonpeptidic anti-infective in a new class of defensin mimetics used for the research of eye infections.

Formula: C₄₀H₅₀F₆N₁₄O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 936.91

Ref: TM-T14781

Brilacidin

CAS: 1224095-98-0

Formula: C₄₀H₅₀F₆N₁₄O₆

Molecular weight: 936.93

Ref: 4Z-B-102001

Brilacidin

CAS: 1224095-98-0

Brilacidin is a synthetic antimicrobial peptide mimetic, which is derived from the host defense proteins found in nature. It functions by mimicking the mechanism of these peptides, disrupting microbial cell membranes and inhibiting biofilm formation. The compound destabilizes the phospholipid bilayer of bacterial membranes, leading to increased permeability and subsequent cell death.

Formula: C₄₀H₅₀F₆N₁₄O₆

Purity: Min. 95%

Molecular weight: 936.9 g/mol

Ref: 3D-ZYB09598