CymitQuimica logo

CAS 122430-79-9

:

2-TERT-BUTYL-4-[3-(DIMETHYLVINYLSILANYL)PROPOXY]-6-(5-METHOXYBENZOTRIAZOL-2-YL)-PHENOL

Description:
2-Tert-butyl-4-[3-(dimethylvinylsilanylm)propyloxy]-6-(5-methoxybenzotriazol-2-yl)-phenol is a complex organic compound characterized by its multifunctional structure, which includes a phenolic core, a tert-butyl group, and a benzotriazole moiety. The presence of the tert-butyl group contributes to its hydrophobic properties, while the benzotriazole unit is known for its UV-absorbing capabilities, making it useful in applications requiring UV stabilization. The dimethylvinylsilanylm group introduces silicon into the structure, enhancing its thermal stability and potentially improving its compatibility with various polymers. This compound may exhibit antioxidant properties due to the phenolic structure, which can scavenge free radicals. Its unique combination of functional groups suggests potential applications in fields such as materials science, coatings, and pharmaceuticals, particularly in formulations that require UV protection and enhanced stability. However, specific physical and chemical properties such as solubility, melting point, and reactivity would need to be determined through experimental methods or detailed literature review for practical applications.
Formula:C24H33N3O3Si
InChI:InChI=1/C24H33N3O3Si/c1-8-31(6,7)13-9-12-30-18-14-19(24(2,3)4)23(28)22(16-18)27-25-20-11-10-17(29-5)15-21(20)26-27/h8,10-11,14-16,28H,1,9,12-13H2,2-7H3
SMILES:C=C[Si](C)(C)CCCOc1cc(c(c(c1)n1nc2ccc(cc2n1)OC)O)C(C)(C)C
Synonyms:
  • 2-tert-Butyl-4-[3-(dimethylvinylsilanyl)propoxy]-6-(5-methoxybenzotriazol-2-yl)-p
  • 2-tert-butyl-4-{3-[ethenyl(dimethyl)silyl]propoxy}-6-(5-methoxy-2H-benzotriazol-2-yl)phenol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.