CAS 122431-24-7
:Flupyrazofos
Description:
Flupyrazofos is an organophosphorus compound primarily used as an insecticide and acaricide in agricultural applications. It functions by inhibiting the enzyme acetylcholinesterase, leading to the accumulation of acetylcholine at nerve synapses, which disrupts normal nerve function in pests. This compound is characterized by its relatively high toxicity to insects while being designed to minimize effects on non-target organisms, including humans and beneficial insects. Flupyrazofos is typically applied in various formulations, including emulsifiable concentrates and granules, and is effective against a range of agricultural pests. Its chemical structure includes a pyrazole ring, contributing to its biological activity. As with many pesticides, proper handling and application are crucial to mitigate environmental impact and ensure safety. Regulatory assessments evaluate its environmental fate, potential for bioaccumulation, and toxicity to non-target species, guiding its use in integrated pest management strategies.
Formula:C14H16F3N2O3PS
InChI:InChI=1S/C14H16F3N2O3PS/c1-3-20-23(24,21-4-2)22-13-10-12(14(15,16)17)18-19(13)11-8-6-5-7-9-11/h5-10H,3-4H2,1-2H3
InChI key:InChIKey=JZUKGAJJLZRHGL-UHFFFAOYSA-N
SMILES:O(P(OCC)(OCC)=S)C=1N(N=C(C(F)(F)F)C1)C2=CC=CC=C2
Synonyms:- Flupyrazofos
- Flupyrazophos
- Kh 502
- O,O-Diethyl O-(1-phenyl-3-trifluoromethyl-5-pyrazolyl) thiophosphate
- O,O-diethyl O-[1-phenyl-3-(trifluoromethyl)-1H-pyrazol-4-yl] phosphorothioate
- Phosphorothioic acid, O,O-diethyl O-[1-phenyl-3-(trifluoromethyl)-1H-pyrazol-5-yl] ester
- Thiophosphoric acid O,O-diethyl O-[1-phenyl-3-(trifluoromethyl)-1H-pyrazol-5-yl] ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Flupyrazofos
CAS:Controlled ProductFormula:C14H16F3N2O3PSColor and Shape:NeatMolecular weight:380.322
