CAS 122442-02-8

(3S)-3-Pyrrolidineacetic acid

Description:

(3S)-3-Pyrrolidineacetic acid, with the CAS number 122442-02-8, is an organic compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features a carboxylic acid functional group, contributing to its acidic properties. The stereochemistry indicated by the (3S) designation suggests that the molecule has a specific three-dimensional arrangement, which can influence its biological activity and interactions. Typically, compounds like (3S)-3-Pyrrolidineacetic acid are studied for their potential applications in pharmaceuticals, particularly in the development of drugs targeting neurological conditions or as intermediates in organic synthesis. Its solubility in water and organic solvents can vary, affecting its behavior in biological systems and chemical reactions. Additionally, the presence of the pyrrolidine moiety may impart unique properties such as the ability to form hydrogen bonds, which can be crucial for its reactivity and interaction with biological macromolecules. Overall, (3S)-3-Pyrrolidineacetic acid is of interest in both synthetic and medicinal chemistry contexts.

Formula: C₆H₁₁NO₂

InChI: InChI=1S/C6H11NO2/c8-6(9)3-5-1-2-7-4-5/h5,7H,1-4H2,(H,8,9)/t5-/m0/s1

InChI key: InChIKey=OUENRUZPZZFMCA-YFKPBYRVSA-N

SMILES: C(C(O)=O)[C@@H]1CCNC1

Synonyms:

• (3S)-3-Pyrrolidineacetic acid
• 3-Pyrrolidineacetic acid, (3S)-
• (S)-Pyrrolidine-3-acetic acid
• 3-Pyrrolidineacetic acid (3S)-
• 3-Pyrrolidineacetic acid, (S)-

3-Pyrrolidineacetic acid, (3S)-

CAS: 122442-02-8

Formula: C₆H₁₁NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 129.1570

Ref: IN-DA00178U

(S)-2-(Pyrrolidin-3-yl)acetic acid

CAS: 122442-02-8

(S)-2-(Pyrrolidin-3-yl)acetic acid

Purity: 97%

Ref: 54-OR1037901

(S)-2-(Pyrrolidin-3-yl)acetic acid

CAS: 122442-02-8

Formula: C₆H₁₁NO₂

Purity: 97%

Molecular weight: 129.159

Ref: 10-F324272