CAS 122450-96-8

7-bromo-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one

Description:

7-Bromo-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both a pyridine and an oxazine moiety. The presence of the bromine atom at the 7-position contributes to its reactivity and potential applications in medicinal chemistry. This compound features a carbonyl group, which is indicative of its classification as a ketone, and the oxazine ring adds to its stability and unique chemical properties. It is typically synthesized through multi-step organic reactions involving bromination and cyclization processes. The compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its solubility and stability in various solvents can vary, influencing its application in different chemical environments. As with many heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions, depending on the functional groups present. Overall, 7-bromo-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one represents a valuable structure in the field of organic and medicinal chemistry.

Formula: C₇H₅BrN₂O₂

InChI: InChI=1/C7H5BrN2O2/c8-4-1-5-7(9-2-4)10-6(11)3-12-5/h1-2H,3H2,(H,9,10,11)

SMILES: c1c(cnc2c1OCC(=N2)O)Br

Synonyms:

• 2H-pyrido[3,2-b]-1,4-oxazin-3(4H)-one, 7-bromo-
• 7-Bromo-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one

2H-Pyrido[3,2-b]-1,4-oxazin-3(4H)-one, 7-bromo-

CAS: 122450-96-8

Formula: C₇H₅BrN₂O₂

Purity: 96%

Color and Shape: Liquid

Molecular weight: 229.0308

Ref: IN-DA00178N

7-Bromo-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one

CAS: 122450-96-8

7-Bromo-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one

Purity: 98%

Molecular weight: 229.03g/mol

Ref: 54-OR90427

7-Bromo-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one

CAS: 122450-96-8

Formula: C₇H₅BrN₂O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 229.033

Ref: 10-F224925