CymitQuimica logo

CAS 122453-72-9

:

2-(4-CHLOROPHENYL)-4-BROMO-1-METHYL-5-(TRIFLUOROMETHYL)-1H-PYRROLE-3-CARBONITRILE

Description:
2-(4-Chlorophenyl)-4-bromo-1-methyl-5-(trifluoromethyl)-1H-pyrrole-3-carbonitrile, with the CAS number 122453-72-9, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyrrole ring substituted with various functional groups. The presence of a bromine atom and a trifluoromethyl group contributes to its unique chemical reactivity and potential applications in pharmaceuticals or agrochemicals. The chlorophenyl group enhances its lipophilicity, which may influence its biological activity and solubility in organic solvents. This compound is likely to exhibit interesting electronic properties due to the electron-withdrawing effects of the trifluoromethyl and cyano groups, making it a candidate for studies in medicinal chemistry or materials science. Additionally, its stability under various conditions can be attributed to the aromatic and heterocyclic components of its structure. As with many halogenated compounds, it is essential to handle this substance with care due to potential toxicity and environmental impact.
Formula:C13H7BrClF3N2
InChI:InChI=1/C13H7BrClF3N2/c1-20-11(7-2-4-8(15)5-3-7)9(6-19)10(14)12(20)13(16,17)18/h2-5H,1H3
SMILES:Cn1c(c2ccc(cc2)Cl)c(C#N)c(c1C(F)(F)F)Br
Synonyms:
  • 4-Bromo-2-(4-chlorophenyl)-1-methyl-5-(trifluoromethyl)pyrrole-3-carbonitrile
  • 4-bromo-2-(4-chlorophenyl)-1-methyl-5-(trifluoromethyl)-1H-pyrrole-3-carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.