CAS 122455-86-1

Carbonic acid, 4-fluoro-2-methylphenyl methyl ester

Description:

Carbonic acid, 4-fluoro-2-methylphenyl methyl ester, also known by its CAS number 122455-86-1, is an organic compound characterized by the presence of a carbonic acid moiety esterified with a 4-fluoro-2-methylphenyl group. This compound features a carbonyl group (C=O) linked to an alkoxy group (–O–), which is typical of esters. The presence of the 4-fluoro substituent indicates that there is a fluorine atom attached to the aromatic ring, which can influence the compound's reactivity and polarity. The methyl group on the aromatic ring contributes to the overall hydrophobic character of the molecule. Carbonic acid esters are often used in various applications, including as intermediates in organic synthesis and in the production of pharmaceuticals. The specific properties, such as solubility, boiling point, and reactivity, can vary based on the molecular structure and the presence of functional groups. Overall, this compound exemplifies the diverse chemistry of carbonic acid derivatives and their potential utility in chemical synthesis.

Formula: C₉H₉FO₃

InChI: InChI=1S/C9H9FO3/c1-6-5-7(10)3-4-8(6)13-9(11)12-2/h3-5H,1-2H3

InChI key: InChIKey=KIQNTUVEIYAMDA-UHFFFAOYSA-N

SMILES: O(C(OC)=O)C1=C(C)C=C(F)C=C1

Synonyms:

• 4-Fluoro-2-methylphenyl methyl carbonate
• Methyl 4-fluoro-2-methylphenyl carbonate
• Carbonic acid, 4-fluoro-2-methylphenyl methyl ester