CAS 1224604-11-8

5-Bromo-N,3-dimethyl-2-pyridinecarboxamide

Description:

5-Bromo-N,3-dimethyl-2-pyridinecarboxamide is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 5-position and a dimethyl group at the 3-position contributes to its unique properties. This compound is typically classified as an amide due to the carboxamide functional group, which is known for its ability to form hydrogen bonds, influencing its solubility and reactivity. The bromine substituent can enhance the compound's reactivity in various chemical reactions, including nucleophilic substitutions. Additionally, the dimethyl groups can affect steric hindrance and electronic properties, potentially influencing biological activity. This compound may be of interest in pharmaceutical research and development due to its structural features, which could lead to specific interactions with biological targets. Overall, 5-Bromo-N,3-dimethyl-2-pyridinecarboxamide exhibits characteristics typical of halogenated amides, with potential applications in medicinal chemistry and related fields.

Formula: C₈H₉BrN₂O

InChI: InChI=1S/C8H9BrN2O/c1-5-3-6(9)4-11-7(5)8(12)10-2/h3-4H,1-2H3,(H,10,12)

InChI key: InChIKey=YLKTXIHURDUGMP-UHFFFAOYSA-N

SMILES: C(NC)(=O)C1=C(C)C=C(Br)C=N1

Synonyms:

• 5-Bromo-N-methyl-3-methylpicolinamide
• 2-Pyridinecarboxamide, 5-bromo-N,3-dimethyl-
• 5-Bromo-N,3-dimethyl-2-pyridinecarboxamide
• 5-Bromo-N-methoxy-N,3-dimethylpicolinamide
• 5-BroMo-N,3-diMethylpicolinaMide
• 5-Bromo-3-methyl-N-methylpyridine-2-carboxamide

2-Pyridinecarboxamide, 5-bromo-N,3-dimethyl-

CAS: 1224604-11-8

Formula: C₈H₉BrN₂O

Purity: 95%

Molecular weight: 229.0739

Ref: IN-DA001793

5-Bromo-3-methyl-N-methylpyridine-2-carboxamide

CAS: 1224604-11-8

Purity: ≥95%

Molecular weight: 229.0769958

Ref: 10-F632695