
CAS 1224698-11-6
:(7aS)-Hexahydro-2-(4-piperidinyl)-3H-pyrrolo[1,2-c]imidazol-3-one
Description:
(7aS)-Hexahydro-2-(4-piperidinyl)-3H-pyrrolo[1,2-c]imidazol-3-one is a chemical compound characterized by its complex bicyclic structure, which includes a piperidine ring and a pyrrolo[1,2-c]imidazole framework. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in organic solvents. Its molecular structure suggests it may engage in hydrogen bonding due to the presence of nitrogen atoms, which can influence its reactivity and interactions with biological targets. The piperidine moiety may contribute to its pharmacological properties, potentially making it relevant in medicinal chemistry. Additionally, the stereochemistry indicated by the (7aS) designation suggests specific spatial arrangements that can affect the compound's biological activity and binding affinity. Overall, this compound may be of interest in research related to drug development, particularly in areas targeting neurological or psychiatric conditions, although specific biological activities would require further investigation.
Formula:C11H19N3O
InChI:InChI=1S/C11H19N3O/c15-11-13-7-1-2-10(13)8-14(11)9-3-5-12-6-4-9/h9-10,12H,1-8H2/t10-/m0/s1
InChI key:InChIKey=XKZVHWQXRLXOEB-JTQLQIEISA-N
SMILES:O=C1N(C[C@]2(N1CCC2)[H])C3CCNCC3
Synonyms:- 3H-Pyrrolo[1,2-c]imidazol-3-one, hexahydro-2-(4-piperidinyl)-, (7aS)-
- (7AS)-2-piperidin-4-yl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-3-one
- (7aS)-Hexahydro-2-(4-piperidinyl)-3H-pyrrolo[1,2-c]imidazol-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.