CAS 1224698-12-7

(7aR)-Hexahydro-2-(4-piperidinyl)-3H-pyrrolo[1,2-c]imidazol-3-one

Description:

(7aR)-Hexahydro-2-(4-piperidinyl)-3H-pyrrolo[1,2-c]imidazol-3-one is a chemical compound characterized by its complex bicyclic structure, which includes a piperidine ring and a pyrrolo[1,2-c]imidazole moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents. Its molecular structure suggests the presence of multiple functional groups, which may contribute to its biological activity and interactions with various receptors or enzymes. The stereochemistry indicated by the (7aR) designation implies specific spatial arrangements of atoms, which can significantly influence the compound's pharmacological properties. Compounds of this nature are often investigated for their potential therapeutic applications, particularly in the fields of neuroscience and medicinal chemistry, due to their ability to interact with neurotransmitter systems. Safety and handling considerations are essential, as with any chemical substance, and appropriate measures should be taken to ensure safe usage in laboratory or industrial settings.

Formula: C₁₁H₁₉N₃O

InChI: InChI=1S/C11H19N3O/c15-11-13-7-1-2-10(13)8-14(11)9-3-5-12-6-4-9/h9-10,12H,1-8H2/t10-/m1/s1

InChI key: InChIKey=XKZVHWQXRLXOEB-SNVBAGLBSA-N

SMILES: O=C1N(C[C@@]2(N1CCC2)[H])C3CCNCC3

Synonyms:

• (7AR)-2-piperidin-4-yl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c]imidazol-3-one
• (7aR)-Hexahydro-2-(4-piperidinyl)-3H-pyrrolo[1,2-c]imidazol-3-one
• 3H-Pyrrolo[1,2-c]imidazol-3-one, hexahydro-2-(4-piperidinyl)-, (7aR)-