CAS 1224740-83-3
:5-[2-(Trifluoromethyl)phenyl]-3-pyridinamine
Description:
5-[2-(Trifluoromethyl)phenyl]-3-pyridinamine, identified by its CAS number 1224740-83-3, is an organic compound characterized by its unique molecular structure, which includes a pyridine ring and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the amino group. The trifluoromethyl group is known for its electron-withdrawing effects, which can influence the compound's reactivity and solubility in various solvents. Additionally, the presence of the amino group may impart basicity and potential for hydrogen bonding, affecting its interactions in biological systems or chemical reactions. Such compounds are often of interest in medicinal chemistry and materials science due to their potential applications in drug development and as intermediates in synthetic pathways. Overall, the characteristics of this compound make it a subject of interest for further research and application in various chemical fields.
Formula:C12H9F3N2
InChI:InChI=1S/C12H9F3N2/c13-12(14,15)11-4-2-1-3-10(11)8-5-9(16)7-17-6-8/h1-7H,16H2
InChI key:InChIKey=DWAGWKHRLQFSEC-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(C=CC=C1)C=2C=C(N)C=NC2
Synonyms:- 3-Pyridinamine, 5-[2-(trifluoromethyl)phenyl]-
- 5-[2-(Trifluoromethyl)phenyl]-3-pyridinamine
- 5-[2-(Trifluoromethyl)phenyl]pyridin-3-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
