CAS 1224888-36-1

5-Amino-1-ethyl-N,N-dimethyl-1H-pyrazole-3-methanamine

Description:

5-Amino-1-ethyl-N,N-dimethyl-1H-pyrazole-3-methanamine is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an amino group and a methanamine moiety, contributing to its potential as a building block in pharmaceutical synthesis or as a ligand in coordination chemistry. The presence of both ethyl and dimethyl groups indicates that it has a degree of steric hindrance, which may influence its reactivity and interactions with biological targets. The compound's solubility, stability, and reactivity can vary depending on the specific conditions, such as pH and temperature. Additionally, its functional groups suggest potential applications in medicinal chemistry, particularly in the development of drugs targeting various biological pathways. As with many nitrogen-containing heterocycles, it may exhibit interesting pharmacological properties, making it a subject of interest in research and development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₈H₁₆N₄

InChI: InChI=1S/C8H16N4/c1-4-12-8(9)5-7(10-12)6-11(2)3/h5H,4,6,9H2,1-3H3

InChI key: InChIKey=JWCKEWGTZYGVOU-UHFFFAOYSA-N

SMILES: C(N(C)C)C1=NN(CC)C(N)=C1

Synonyms:

• 1H-Pyrazole-3-methanamine, 5-amino-1-ethyl-N,N-dimethyl-
• 3-[(Dimethylamino)methyl]-1-ethyl-1H-pyrazol-5-amine
• 5-Amino-1-ethyl-N,N-dimethyl-1H-pyrazole-3-methanamine