CymitQuimica logo

CAS 122489-60-5

:

2,4,6-Tris(trifluoromethyl)phenol

Description:
2,4,6-Tris(trifluoromethyl)phenol, with the CAS number 122489-60-5, is a chemical compound characterized by its phenolic structure, where three trifluoromethyl groups are substituted at the 2, 4, and 6 positions of the phenol ring. This substitution significantly enhances its hydrophobicity and lipophilicity due to the presence of the highly electronegative fluorine atoms. The compound exhibits strong acidity, typical of phenolic compounds, and can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Its trifluoromethyl groups contribute to its unique electronic properties, making it a subject of interest in materials science and organic synthesis. Additionally, 2,4,6-Tris(trifluoromethyl)phenol may exhibit antimicrobial and antifungal activities, which can be explored for potential applications in pharmaceuticals and agrochemicals. Safety data should be consulted for handling and exposure risks, as fluorinated compounds can pose environmental and health concerns. Overall, this compound is notable for its distinctive structure and potential utility in various chemical applications.
Formula:C9H3F9O
InChI:InChI=1/C9H3F9O/c10-7(11,12)3-1-4(8(13,14)15)6(19)5(2-3)9(16,17)18/h1-2,19H
SMILES:c1c(cc(c(c1C(F)(F)F)O)C(F)(F)F)C(F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.